CAS 1219795-35-3 appears in our catalog under these names: Ethyl Dodecanoate-d23, 98 atom % D, min 98% Chemical Purity, Ethyl Laurate-d23. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 5mg, 1mg.
Ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosadeuteriododecanoate (CAS 1219795-35-3) is a chemical compound with the molecular formula C14H28O2 and a molecular weight of 251.51 g/mol. IUPAC name: ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosadeuteriododecanoate. InChIKey: MMXKVMNBHPAILY-WZPUNXEVSA-N.
| Molecular formula | C14H28O2 |
|---|---|
| Molecular weight | 251.51 g/mol |
| IUPAC name | ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosadeuteriododecanoate |
| InChIKey | MMXKVMNBHPAILY-WZPUNXEVSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OCC |
Computed by PubChem (NCBI)