CAS 1219795-53-5 appears in our catalog under these names: Ethyl Paraben-d4, >95% (HPLC), Ethyl 4-Hydroxybenzoate-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity, 4-Hydroxybenzoic acid-ethyl ester D4 (ring D4), Ethylparaben-d4, 99.60%, D4-Ethylparaben, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, CDN, Dr. Ehrenstorfer, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 25mg, 0,1g, 0,05g, 10 mg, 1 mg, 5 mg, 1x1ml.
Ethyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate (CAS 1219795-53-5) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 170.20 g/mol. IUPAC name: ethyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate. InChIKey: NUVBSKCKDOMJSU-LNFUJOGGSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 170.20 g/mol |
| IUPAC name | ethyl 2,3,5,6-tetradeuterio-4-hydroxybenzoate |
| InChIKey | NUVBSKCKDOMJSU-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)OCC)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)