Products 2075718-25-9
CAS 2075718-25-9 is the registry number for Ethyl Paraben-13C6, 99.65%. Offered by: MedChemExpress. Available pack sizes: 1 mg.
Ethyl 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate (CAS 2075718-25-9) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 172.13 g/mol. IUPAC name: ethyl 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate. InChIKey: NUVBSKCKDOMJSU-LSYAIDEBSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | ethyl 4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylate |
| InChIKey | NUVBSKCKDOMJSU-LSYAIDEBSA-N |
| SMILES | CCOC(=O)[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)O |
Computed by PubChem (NCBI)
Synonyms:
Ethyl Paraben-13C6