Products 1219798-38-5
CAS 1219798-38-5 appears in our catalog under these names: Ethyl Octanoate-d15, >95% (GC), Ethyl Octanoate-d15, 98 atom % D, min 98% Chemical Purity, Ethyl octanoate-d15, 99.40%. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 25mg, 50mg, 5mg, 0,5g, 0,25g, 10 mg, 1 mg, 100 mg.
Ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecadeuteriooctanoate (CAS 1219798-38-5) is a chemical compound with the molecular formula C10H20O2 and a molecular weight of 187.36 g/mol. IUPAC name: ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecadeuteriooctanoate. InChIKey: YYZUSRORWSJGET-MVIIYOROSA-N.
| Molecular formula | C10H20O2 |
|---|---|
| Molecular weight | 187.36 g/mol |
| IUPAC name | ethyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecadeuteriooctanoate |
| InChIKey | YYZUSRORWSJGET-MVIIYOROSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)OCC |
Computed by PubChem (NCBI)