Products 1219798-53-4
CAS 1219798-53-4 appears in our catalog under these names: N–(4–Hydroxyphenyl–2，3，5，6–d4)acetamide–2，2，2–d3, N-(4-Hydroxyphenyl-2,3,5,6-d4)acetamide-2,2,2-d3, 98 atom % D, min 98% Chemical Purity, Acetaminophen–d7, Acetaminophen-d7, 99.92%. Offered by: GLPBio, CDN, MedChemExpress. Available pack sizes: 10mg, 0,25g, 0,1g, 1mg, 5mg, 5 mg, 10 mg, 1 mg.
2,2,2-trideuterio-N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetamide (CAS 1219798-53-4) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 158.21 g/mol. IUPAC name: 2,2,2-trideuterio-N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetamide. InChIKey: RZVAJINKPMORJF-AAYPNNLASA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 158.21 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)acetamide |
| InChIKey | RZVAJINKPMORJF-AAYPNNLASA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1NC(=O)C([2H])([2H])[2H])[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)