Products 2132405-57-1
CAS 2132405-57-1 is the registry number for Acetaminophen-13C6. Offered by: MedChemExpress. Available pack sizes: 1 mg.
N-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetamide (CAS 2132405-57-1) is a chemical compound with the molecular formula C8H9NO2 and a molecular weight of 157.12 g/mol. IUPAC name: N-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetamide. InChIKey: RZVAJINKPMORJF-CLQMYPOBSA-N.
| Molecular formula | C8H9NO2 |
|---|---|
| Molecular weight | 157.12 g/mol |
| IUPAC name | N-(4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)acetamide |
| InChIKey | RZVAJINKPMORJF-CLQMYPOBSA-N |
| SMILES | CC(=O)N[13C]1=[13CH][13CH]=[13C]([13CH]=[13CH]1)O |
Computed by PubChem (NCBI)
Synonyms:
Acetaminophen-13C6, orb3138850