Products 1219798-61-4
CAS 1219798-61-4 appears in our catalog under these names: Metoprolol-D7 Hydrochloride, >95% (HPLC), (±)-Metoprolol-d7 HCl (iso-propyl-d7), 99 atom % D, min 98% Chemical Purity, Metoprolol–d7 hydrochloride, Metoprolol-d7 (hydrochloride), 99.71%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 0,01g, 0,005g, 5 mg, 1 mg, 10 mg.
1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol;hydrochloride (CAS 1219798-61-4) is a chemical compound with the molecular formula C15H26ClNO3 and a molecular weight of 310.87 g/mol. IUPAC name: 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol;hydrochloride. InChIKey: UKBBZNRSHOCRNP-ODLOEXKQSA-N.
| Molecular formula | C15H26ClNO3 |
|---|---|
| Molecular weight | 310.87 g/mol |
| IUPAC name | 1-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-3-[4-(2-methoxyethyl)phenoxy]propan-2-ol;hydrochloride |
| InChIKey | UKBBZNRSHOCRNP-ODLOEXKQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=C(C=C1)CCOC)O.Cl |
Computed by PubChem (NCBI)