CAS 5696-15-1 appears in our catalog under these names: Butoxamine Hydrochloride, α-[1-(tert-Butylamino)ethyl]-2,5-dimethoxybenzyl alcohol hydrochloride, ≥96%, ≥96%, Butaxamine (hydrochloride), 99.87%. Offered by: TRC, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 250mg, 50MG, 10mg, 25mg, 100mg, 10 mg, 5 mg.
2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol;hydrochloride (CAS 5696-15-1) is a chemical compound with the molecular formula C15H26ClNO3 and a molecular weight of 303.82 g/mol. IUPAC name: 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol;hydrochloride. InChIKey: URPAECSKKQLCII-UHFFFAOYSA-N.
| Molecular formula | C15H26ClNO3 |
|---|---|
| Molecular weight | 303.82 g/mol |
| IUPAC name | 2-(tert-butylamino)-1-(2,5-dimethoxyphenyl)propan-1-ol;hydrochloride |
| InChIKey | URPAECSKKQLCII-UHFFFAOYSA-N |
| SMILES | CC(C(C1=C(C=CC(=C1)OC)OC)O)NC(C)(C)C.Cl |
Computed by PubChem (NCBI)