Products 1219798-63-6
CAS 1219798-63-6 appears in our catalog under these names: 2,5-Difluorobenzoic-d3 Acid, 98 atom % D, min 98% Chemical Purity, 2,5-Difluorobenzoic acid-d3, 98.9%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 50 mg, 10 mg, 5 mg, 25 mg.
2,4,5-trideuterio-3,6-difluorobenzoic acid (CAS 1219798-63-6) is a chemical compound with the molecular formula C7H4F2O2 and a molecular weight of 161.12 g/mol. IUPAC name: 2,4,5-trideuterio-3,6-difluorobenzoic acid. InChIKey: LBQMIAVIGLLBGW-CBYSEHNBSA-N.
| Molecular formula | C7H4F2O2 |
|---|---|
| Molecular weight | 161.12 g/mol |
| IUPAC name | 2,4,5-trideuterio-3,6-difluorobenzoic acid |
| InChIKey | LBQMIAVIGLLBGW-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1F)[2H])C(=O)O)F)[2H] |
Computed by PubChem (NCBI)