Products 1219798-69-2
CAS 1219798-69-2 appears in our catalog under these names: 2,3,3′,4,5,5′-Hexachlorobiphenyl-2′,4′,6′-d3, 2,3,3',4,5,5'-Hexchlorobiphenyl-2',4',6'-d3, 98 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 1 mg, 0,01g, 0,005g.
1,3-dichloro-2,4,6-trideuterio-5-(2,3,4,5-tetrachlorophenyl)benzene (CAS 1219798-69-2) is a chemical compound with the molecular formula C12H4Cl6 and a molecular weight of 363.9 g/mol. IUPAC name: 1,3-dichloro-2,4,6-trideuterio-5-(2,3,4,5-tetrachlorophenyl)benzene. InChIKey: YZKLGRAIIIGOHB-CBYSEHNBSA-N.
| Molecular formula | C12H4Cl6 |
|---|---|
| Molecular weight | 363.9 g/mol |
| IUPAC name | 1,3-dichloro-2,4,6-trideuterio-5-(2,3,4,5-tetrachlorophenyl)benzene |
| InChIKey | YZKLGRAIIIGOHB-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Cl)[2H])Cl)[2H])C2=CC(=C(C(=C2Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)