CAS 39635-35-3 appears in our catalog under these names: 2,3,3',4,5,5'-Hexachlorobiphenyl, PCB 159, ROTI®Star, 5 mg, glass. Offered by: Biosynth, Roth. Available pack sizes: 10ml, 5ml, 25ml, 50ml, 5mg.
1,2,3,4-tetrachloro-5-(3,5-dichlorophenyl)benzene (CAS 39635-35-3) is a chemical compound with the molecular formula C12H4Cl6 and a molecular weight of 360.9 g/mol. IUPAC name: 1,2,3,4-tetrachloro-5-(3,5-dichlorophenyl)benzene. InChIKey: YZKLGRAIIIGOHB-UHFFFAOYSA-N.
| Molecular formula | C12H4Cl6 |
|---|---|
| Molecular weight | 360.9 g/mol |
| IUPAC name | 1,2,3,4-tetrachloro-5-(3,5-dichlorophenyl)benzene |
| InChIKey | YZKLGRAIIIGOHB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C2=CC(=C(C(=C2Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)