Products 1219798-72-7
CAS 1219798-72-7 appears in our catalog under these names: iso-Propyl 4-Hydroxybenzoate-2,3,5,6-d4, >95% (HPLC), iso-Propyl 4-Hydroxybenzoate-2,3,5,6-d4, 98 atom % D, min 98% Chemical Purity, Isopropyl 4-hydroxybenzoate-d4, D4-Isopropylparaben, D4-Isopropylparaben, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: TRC, CDN, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 1mg, 2mg, 0,1g, 0,05g, 10 mg, 2 mg, 1 mg.
Propan-2-yl 2,3,5,6-tetradeuterio-4-hydroxybenzoate (CAS 1219798-72-7) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 184.22 g/mol. IUPAC name: propan-2-yl 2,3,5,6-tetradeuterio-4-hydroxybenzoate. InChIKey: CMHMMKSPYOOVGI-LNFUJOGGSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 184.22 g/mol |
| IUPAC name | propan-2-yl 2,3,5,6-tetradeuterio-4-hydroxybenzoate |
| InChIKey | CMHMMKSPYOOVGI-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C(=O)OC(C)C)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)