Products 1432063-95-0
CAS 1432063-95-0 appears in our catalog under these names: Isopropyl-d7 Paraben, >95% (HPLC), Isopropyl 4-hydroxybenzoate-d7. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
1,1,1,2,3,3,3-heptadeuteriopropan-2-yl 4-hydroxybenzoate (CAS 1432063-95-0) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 187.24 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl 4-hydroxybenzoate. InChIKey: CMHMMKSPYOOVGI-QXMYYZBZSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 187.24 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl 4-hydroxybenzoate |
| InChIKey | CMHMMKSPYOOVGI-QXMYYZBZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])OC(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)