CAS 1219798-89-6 appears in our catalog under these names: Hydrochlorothiazide-d2, Hydrochlorothiazide-d2, >95% (HPLC), Hydrochlorothiazide D2 (3,3-D2), Hydrochlorothiazide-3,3-d2, 98 atom % D, min 98% Chemical Purity, Hydrochlorothiazid–d2. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, CDN, GLPBio. Available pack sizes: on request, 100mg, 10mg, 1mg, 0,05g, 0,01g, 5mg, 2mg.
6-chloro-3,3-dideuterio-1,1-dioxo-2,4-dihydro-1lambda6,2,4-benzothiadiazine-7-sulfonamide (CAS 1219798-89-6) is a chemical compound with the molecular formula C7H8ClN3O4S2 and a molecular weight of 299.8 g/mol. IUPAC name: 6-chloro-3,3-dideuterio-1,1-dioxo-2,4-dihydro-1lambda6,2,4-benzothiadiazine-7-sulfonamide. InChIKey: JZUFKLXOESDKRF-SMZGMGDZSA-N.
| Molecular formula | C7H8ClN3O4S2 |
|---|---|
| Molecular weight | 299.8 g/mol |
| IUPAC name | 6-chloro-3,3-dideuterio-1,1-dioxo-2,4-dihydro-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| InChIKey | JZUFKLXOESDKRF-SMZGMGDZSA-N |
| SMILES | [2H]C1(NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl)[2H] |
Computed by PubChem (NCBI)