CAS 856302-12-0 appears in our catalog under these names: Hydrochlorothiazide Impurity 22, 5-Chloro-1,1-dioxo-3,4-dihydro-2H-benzo(e)(1,2,4)thiadiazine-7-sulfonamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
5-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide (CAS 856302-12-0) is a chemical compound with the molecular formula C7H8ClN3O4S2 and a molecular weight of 297.7 g/mol. IUPAC name: 5-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide. InChIKey: BLNYGECRDMVABH-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O4S2 |
|---|---|
| Molecular weight | 297.7 g/mol |
| IUPAC name | 5-chloro-1,1-dioxo-3,4-dihydro-2H-1lambda6,2,4-benzothiadiazine-7-sulfonamide |
| InChIKey | BLNYGECRDMVABH-UHFFFAOYSA-N |
| SMILES | C1NC2=C(C=C(C=C2Cl)S(=O)(=O)N)S(=O)(=O)N1 |
Computed by PubChem (NCBI)