Products 1219798-95-4

CAS 1219798-95-4 is the registry number for 3,5-Dibromo-4-hydroxybenzonitrile-2,6-d2, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,05g, 0,01g.

Structural formula: {0} (CAS {1})

3,5-dibromo-2,6-dideuterio-4-hydroxybenzonitrile (CAS 1219798-95-4) is a chemical compound with the molecular formula C7H3Br2NO and a molecular weight of 278.92 g/mol. IUPAC name: 3,5-dibromo-2,6-dideuterio-4-hydroxybenzonitrile. InChIKey: UPMXNNIRAGDFEH-QDNHWIQGSA-N.

Identity
Molecular formulaC7H3Br2NO
Molecular weight278.92 g/mol
IUPAC name3,5-dibromo-2,6-dideuterio-4-hydroxybenzonitrile
InChIKeyUPMXNNIRAGDFEH-QDNHWIQGSA-N
SMILES[2H]C1=C(C(=C(C(=C1Br)O)Br)[2H])C#N

Computed by PubChem (NCBI)