CAS 1219798-95-4 is the registry number for 3,5-Dibromo-4-hydroxybenzonitrile-2,6-d2, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,05g, 0,01g.
3,5-dibromo-2,6-dideuterio-4-hydroxybenzonitrile (CAS 1219798-95-4) is a chemical compound with the molecular formula C7H3Br2NO and a molecular weight of 278.92 g/mol. IUPAC name: 3,5-dibromo-2,6-dideuterio-4-hydroxybenzonitrile. InChIKey: UPMXNNIRAGDFEH-QDNHWIQGSA-N.
| Molecular formula | C7H3Br2NO |
|---|---|
| Molecular weight | 278.92 g/mol |
| IUPAC name | 3,5-dibromo-2,6-dideuterio-4-hydroxybenzonitrile |
| InChIKey | UPMXNNIRAGDFEH-QDNHWIQGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Br)O)Br)[2H])C#N |
Computed by PubChem (NCBI)