CAS 2483735-69-7 is the registry number for Bromoxynil (Benzene-13C6). Offered by: TRC. Available pack sizes: 5mg.
3,5-dibromo-4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbonitrile (CAS 2483735-69-7) is a chemical compound with the molecular formula C7H3Br2NO and a molecular weight of 282.87 g/mol. IUPAC name: 3,5-dibromo-4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbonitrile. InChIKey: UPMXNNIRAGDFEH-ZRDHQLPYSA-N.
| Molecular formula | C7H3Br2NO |
|---|---|
| Molecular weight | 282.87 g/mol |
| IUPAC name | 3,5-dibromo-4-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carbonitrile |
| InChIKey | UPMXNNIRAGDFEH-ZRDHQLPYSA-N |
| SMILES | [13CH]1=[13C]([13CH]=[13C]([13C](=[13C]1Br)O)Br)C#N |
Computed by PubChem (NCBI)