Products 1219799-06-0
CAS 1219799-06-0 appears in our catalog under these names: (±)-Propafenone-d7 HCl (n-propyl-d7), 99 atom % D, min 98% Chemical Purity, Propafenone D7 hydrochloride (SA–79 (D7 hydrochloride)), Propafenone-d7 (hydrochloride). Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1mg, 10mg, 5mg, 1 mg, 5 mg.
1-[2-[3-(1,1,2,2,3,3,3-heptadeuteriopropylamino)-2-hydroxypropoxy]phenyl]-3-phenylpropan-1-one;hydrochloride (CAS 1219799-06-0) is a chemical compound with the molecular formula C21H28ClNO3 and a molecular weight of 384.9 g/mol. IUPAC name: 1-[2-[3-(1,1,2,2,3,3,3-heptadeuteriopropylamino)-2-hydroxypropoxy]phenyl]-3-phenylpropan-1-one;hydrochloride. InChIKey: XWIHRGFIPXWGEF-YYEJEILISA-N.
| Molecular formula | C21H28ClNO3 |
|---|---|
| Molecular weight | 384.9 g/mol |
| IUPAC name | 1-[2-[3-(1,1,2,2,3,3,3-heptadeuteriopropylamino)-2-hydroxypropoxy]phenyl]-3-phenylpropan-1-one;hydrochloride |
| InChIKey | XWIHRGFIPXWGEF-YYEJEILISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])NCC(COC1=CC=CC=C1C(=O)CCC2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)