Products 1398066-02-8
CAS 1398066-02-8 appears in our catalog under these names: Propafenone-d5 Hydrochloride, >95% (HPLC), (±)-Propafenone-d5 HCl (n-propyl-2,2,3,3,3-d5), 98 atom % D, min 98% Chemical Purity, Propafenone-d5 (hydrochloride)(Ethyl). Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 1mg, 5mg, 0,01g, 0,005g, 1 mg, 5 mg.
1-[2-[2-hydroxy-3-(2,2,3,3,3-pentadeuteriopropylamino)propoxy]phenyl]-3-phenylpropan-1-one;hydrochloride (CAS 1398066-02-8) is a chemical compound with the molecular formula C21H28ClNO3 and a molecular weight of 382.9 g/mol. IUPAC name: 1-[2-[2-hydroxy-3-(2,2,3,3,3-pentadeuteriopropylamino)propoxy]phenyl]-3-phenylpropan-1-one;hydrochloride. InChIKey: XWIHRGFIPXWGEF-LUIAAVAXSA-N.
| Molecular formula | C21H28ClNO3 |
|---|---|
| Molecular weight | 382.9 g/mol |
| IUPAC name | 1-[2-[2-hydroxy-3-(2,2,3,3,3-pentadeuteriopropylamino)propoxy]phenyl]-3-phenylpropan-1-one;hydrochloride |
| InChIKey | XWIHRGFIPXWGEF-LUIAAVAXSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])CNCC(COC1=CC=CC=C1C(=O)CCC2=CC=CC=C2)O.Cl |
Computed by PubChem (NCBI)