Products 1219799-11-7
CAS 1219799-11-7 appears in our catalog under these names: Promecarb-d3, >95% (HPLC), Promecarb-d3 (N-methyl-d3), 99 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 10mg, 1mg, 0,05g, 0,01g.
(3-methyl-5-propan-2-ylphenyl) N-(trideuteriomethyl)carbamate (CAS 1219799-11-7) is a chemical compound with the molecular formula C12H17NO2 and a molecular weight of 210.29 g/mol. IUPAC name: (3-methyl-5-propan-2-ylphenyl) N-(trideuteriomethyl)carbamate. InChIKey: DTAPQAJKAFRNJB-GKOSEXJESA-N.
| Molecular formula | C12H17NO2 |
|---|---|
| Molecular weight | 210.29 g/mol |
| IUPAC name | (3-methyl-5-propan-2-ylphenyl) N-(trideuteriomethyl)carbamate |
| InChIKey | DTAPQAJKAFRNJB-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)OC1=CC(=CC(=C1)C(C)C)C |
Computed by PubChem (NCBI)