Products 1219802-26-2
CAS 1219802-26-2 appears in our catalog under these names: Monoisobutyl Phthalate-d4, >95% (HPLC), mono-iso-Butyl Phthalate-3,4,5,6-d4, 99 atom % D, min 98% Chemical Purity, Monoisobutyl phthalic acid–d4, Monoisobutyl phthalic acid-d4, 99.36%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 0,1g, 0,05g, 10mg, 10 mg, 5 mg, 50 mg.
2,3,4,5-tetradeuterio-6-(2-methylpropoxycarbonyl)benzoic acid (CAS 1219802-26-2) is a chemical compound with the molecular formula C12H14O4 and a molecular weight of 226.26 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(2-methylpropoxycarbonyl)benzoic acid. InChIKey: RZJSUWQGFCHNFS-LNFUJOGGSA-N.
| Molecular formula | C12H14O4 |
|---|---|
| Molecular weight | 226.26 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(2-methylpropoxycarbonyl)benzoic acid |
| InChIKey | RZJSUWQGFCHNFS-LNFUJOGGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)C(=O)OCC(C)C)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Monoisobutyl Phthalate-d4, Monoisobutyl phthalic acid-d4, 2,3,4,5-tetradeuterio-6-(2-methylpropoxycarbonyl)benzoic acid, 2-[(2-methylpropoxy)carbonyl](?H?)benzoic acid, Mono-iso-butyl phthalate-3,4,5,6-d4, 2-[(2-Methylpropoxy)carbonyl](~2~H_4_)benzoic acid, 2,3,4,5-tetradeuterio-6-isobutoxycarbonyl-benzoic acid