Products 1219802-83-1
CAS 1219802-83-1 is the registry number for 1-Bromohexane-1,1,2,2-d4, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1-bromo-1,1,2,2-tetradeuteriohexane (CAS 1219802-83-1) is a chemical compound with the molecular formula C6H13Br and a molecular weight of 169.10 g/mol. IUPAC name: 1-bromo-1,1,2,2-tetradeuteriohexane. InChIKey: MNDIARAMWBIKFW-NZLXMSDQSA-N.
| Molecular formula | C6H13Br |
|---|---|
| Molecular weight | 169.10 g/mol |
| IUPAC name | 1-bromo-1,1,2,2-tetradeuteriohexane |
| InChIKey | MNDIARAMWBIKFW-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(CCCC)C([2H])([2H])Br |
Computed by PubChem (NCBI)