CAS 130131-94-1 appears in our catalog under these names: 1-BROMOHEXANE-D13, 98 ATOM % D, 1-Bromohexane-d13, 98 atom % D, min 98% Chemical Purity. Offered by: Sigma-Aldrich, CDN. Available pack sizes: 5G, 1g, 0,5g.
1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecadeuteriohexane (CAS 130131-94-1) is a chemical compound with the molecular formula C6H13Br and a molecular weight of 178.15 g/mol. IUPAC name: 1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecadeuteriohexane. InChIKey: MNDIARAMWBIKFW-UTBWLCBWSA-N.
| Molecular formula | C6H13Br |
|---|---|
| Molecular weight | 178.15 g/mol |
| IUPAC name | 1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,6-tridecadeuteriohexane |
| InChIKey | MNDIARAMWBIKFW-UTBWLCBWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])Br |
Computed by PubChem (NCBI)