Products 1219802-87-5
CAS 1219802-87-5 appears in our catalog under these names: Propazine-d14 (di-iso-propyl-d14), 98 atom % D, min 98% Chemical Purity, Propazine-d14, 99.0%. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 5 mg, 1 mg.
6-chloro-2-N,4-N-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine (CAS 1219802-87-5) is a chemical compound with the molecular formula C9H16ClN5 and a molecular weight of 243.79 g/mol. IUPAC name: 6-chloro-2-N,4-N-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine. InChIKey: WJNRPILHGGKWCK-ZVEBFXSZSA-N.
| Molecular formula | C9H16ClN5 |
|---|---|
| Molecular weight | 243.79 g/mol |
| IUPAC name | 6-chloro-2-N,4-N-bis(1,1,1,2,3,3,3-heptadeuteriopropan-2-yl)-1,3,5-triazine-2,4-diamine |
| InChIKey | WJNRPILHGGKWCK-ZVEBFXSZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NC1=NC(=NC(=N1)Cl)NC([2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Propazine-d14, propazine-d14 (di-iso-propyl-d14)