Products 1219802-90-0
CAS 1219802-90-0 appears in our catalog under these names: 1,5-Dibromopentane-d10, 98 atom % D, min 98% Chemical Purity, 1,5-Dibromopentane-d10. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
1,5-dibromo-1,1,2,2,3,3,4,4,5,5-decadeuteriopentane (CAS 1219802-90-0) is a chemical compound with the molecular formula C5H10Br2 and a molecular weight of 240.00 g/mol. IUPAC name: 1,5-dibromo-1,1,2,2,3,3,4,4,5,5-decadeuteriopentane. InChIKey: IBODDUNKEPPBKW-YXALHFAPSA-N.
| Molecular formula | C5H10Br2 |
|---|---|
| Molecular weight | 240.00 g/mol |
| IUPAC name | 1,5-dibromo-1,1,2,2,3,3,4,4,5,5-decadeuteriopentane |
| InChIKey | IBODDUNKEPPBKW-YXALHFAPSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])C([2H])([2H])Br)C([2H])([2H])C([2H])([2H])Br |
Computed by PubChem (NCBI)