Products 1219803-12-9
CAS 1219803-12-9 appears in our catalog under these names: 4-Ethylguaiacol-d5, >95% (HPLC), 4-Ethyl-d5-2-methoxyphenol, 98 atom % D, min 98% Chemical Purity, 4-Ethyl-2-methoxyphenol-d5. Offered by: TRC, CDN, MedChemExpress. Available pack sizes: 50mg, 5mg, 0,05g, 0,01g, 5 mg, 50 mg.
2-methoxy-4-(1,1,2,2,2-pentadeuterioethyl)phenol (CAS 1219803-12-9) is a chemical compound with the molecular formula C9H12O2 and a molecular weight of 157.22 g/mol. IUPAC name: 2-methoxy-4-(1,1,2,2,2-pentadeuterioethyl)phenol. InChIKey: CHWNEIVBYREQRF-WNWXXORZSA-N.
| Molecular formula | C9H12O2 |
|---|---|
| Molecular weight | 157.22 g/mol |
| IUPAC name | 2-methoxy-4-(1,1,2,2,2-pentadeuterioethyl)phenol |
| InChIKey | CHWNEIVBYREQRF-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1=CC(=C(C=C1)O)OC |
Computed by PubChem (NCBI)