CAS 1219803-39-0 appears in our catalog under these names: Pendimethalin-d5, >95% (HPLC), Pendimethalin D5 (1-Ethyl(1',1'-D2)propyl(1,2,2-D3)), Pendimethalin D5 (1-Ethyl(1',1'-D2)propyl(1,2,2-D3)) 100 µg/mL in Acetone, Pendimethalin-d5 (N-(1-ethyl-1',1'-d2-propyl-1,2,2-d3)), 98 atom % D, min 98% Chemical Purity, Pendimethalin-d5, 99.9%. Offered by: TRC, Dr. Ehrenstorfer, CDN, MedChemExpress, HPC Standards. Available pack sizes: 10mg, 1mg, 1ml, 0,01g, 0,005g, 1 mg, 1x10mg, 1x1ml.
3,4-dimethyl-2,6-dinitro-N-(2,2,3,4,4-pentadeuteriopentan-3-yl)aniline (CAS 1219803-39-0) is a chemical compound with the molecular formula C13H19N3O4 and a molecular weight of 286.34 g/mol. IUPAC name: 3,4-dimethyl-2,6-dinitro-N-(2,2,3,4,4-pentadeuteriopentan-3-yl)aniline. InChIKey: CHIFOSRWCNZCFN-SPPSLMSISA-N.
| Molecular formula | C13H19N3O4 |
|---|---|
| Molecular weight | 286.34 g/mol |
| IUPAC name | 3,4-dimethyl-2,6-dinitro-N-(2,2,3,4,4-pentadeuteriopentan-3-yl)aniline |
| InChIKey | CHIFOSRWCNZCFN-SPPSLMSISA-N |
| SMILES | [2H]C([2H])(C)C([2H])(C([2H])([2H])C)NC1=C(C=C(C(=C1[N+](=O)[O-])C)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)