CAS 1219803-49-2 appears in our catalog under these names: Trimethyl Orthopropionate-2,2,3,3,3-d5, 98 atom % D, min 97% Chemical Purity, 1,1,1-Trimethoxypropane-d5. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
1,1,1,2,2-pentadeuterio-3,3,3-trimethoxypropane (CAS 1219803-49-2) is a chemical compound with the molecular formula C6H14O3 and a molecular weight of 139.20 g/mol. IUPAC name: 1,1,1,2,2-pentadeuterio-3,3,3-trimethoxypropane. InChIKey: ZGMNAIODRDOMEK-RPIBLTHZSA-N.
| Molecular formula | C6H14O3 |
|---|---|
| Molecular weight | 139.20 g/mol |
| IUPAC name | 1,1,1,2,2-pentadeuterio-3,3,3-trimethoxypropane |
| InChIKey | ZGMNAIODRDOMEK-RPIBLTHZSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(OC)(OC)OC |
Computed by PubChem (NCBI)