Products 1219803-55-0
CAS 1219803-55-0 is the registry number for 3,4-Dimethylphenol-2,5,6-d3,OD, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,5g, 0,25g.
1,2,4-trideuterio-3-deuteriooxy-5,6-dimethylbenzene (CAS 1219803-55-0) is a chemical compound with the molecular formula C8H10O and a molecular weight of 126.19 g/mol. IUPAC name: 1,2,4-trideuterio-3-deuteriooxy-5,6-dimethylbenzene. InChIKey: YCOXTKKNXUZSKD-NKWHLQRWSA-N.
| Molecular formula | C8H10O |
|---|---|
| Molecular weight | 126.19 g/mol |
| IUPAC name | 1,2,4-trideuterio-3-deuteriooxy-5,6-dimethylbenzene |
| InChIKey | YCOXTKKNXUZSKD-NKWHLQRWSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C)C)[2H])O[2H])[2H] |
Computed by PubChem (NCBI)