Products 1219803-73-2
CAS 1219803-73-2 appears in our catalog under these names: 2-Bromo-1,3-difluorobenzene-d3, 1-Bromo-2,6-difluorobenzene-d3, 98 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 10 mg, 5 mg, 0,5g, 0,25g.
1-bromo-3,4,5-trideuterio-2,6-difluorobenzene (CAS 1219803-73-2) is a chemical compound with the molecular formula C6H3BrF2 and a molecular weight of 196.01 g/mol. IUPAC name: 1-bromo-3,4,5-trideuterio-2,6-difluorobenzene. InChIKey: HRZTZLCMURHWFY-CBYSEHNBSA-N.
| Molecular formula | C6H3BrF2 |
|---|---|
| Molecular weight | 196.01 g/mol |
| IUPAC name | 1-bromo-3,4,5-trideuterio-2,6-difluorobenzene |
| InChIKey | HRZTZLCMURHWFY-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])F)Br)F)[2H] |
Computed by PubChem (NCBI)