CAS 1219803-87-8 appears in our catalog under these names: 1-Bromo-2,4-difluorobenzene-d3, 98 atom % D, min 98% Chemical Purity, 1-Bromo-2,4-difluorobenzene-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
1-bromo-2,3,5-trideuterio-4,6-difluorobenzene (CAS 1219803-87-8) is a chemical compound with the molecular formula C6H3BrF2 and a molecular weight of 196.01 g/mol. IUPAC name: 1-bromo-2,3,5-trideuterio-4,6-difluorobenzene. InChIKey: MGHBDQZXPCTTIH-CBYSEHNBSA-N.
| Molecular formula | C6H3BrF2 |
|---|---|
| Molecular weight | 196.01 g/mol |
| IUPAC name | 1-bromo-2,3,5-trideuterio-4,6-difluorobenzene |
| InChIKey | MGHBDQZXPCTTIH-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1F)[2H])F)Br)[2H] |
Computed by PubChem (NCBI)