Products 1219803-86-7
CAS 1219803-86-7 appears in our catalog under these names: 1-Bromo-2,3,5-trichlorobenzene-d2, 98 atom % D, min 98% Chemical Purity, 1-Bromo-2,3,5-trichlorobenzene-d2. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
1-bromo-2,3,5-trichloro-4,6-dideuteriobenzene (CAS 1219803-86-7) is a chemical compound with the molecular formula C6H2BrCl3 and a molecular weight of 262.4 g/mol. IUPAC name: 1-bromo-2,3,5-trichloro-4,6-dideuteriobenzene. InChIKey: WOIGJFAVHOCDDW-QDNHWIQGSA-N.
| Molecular formula | C6H2BrCl3 |
|---|---|
| Molecular weight | 262.4 g/mol |
| IUPAC name | 1-bromo-2,3,5-trichloro-4,6-dideuteriobenzene |
| InChIKey | WOIGJFAVHOCDDW-QDNHWIQGSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1Cl)Cl)Br)[2H])Cl |
Computed by PubChem (NCBI)