Products 1219803-94-7
CAS 1219803-94-7 appears in our catalog under these names: Secobarbital-d5 (1-methyl-d3-butyl-2,2-d2), Secobarbital-d5 (1-methyl-d3-butyl-2,2-d2), 98 atom % D, min 98% Chemical Purity. Offered by: Hubei YoungXin, CDN. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 0,01g.
5-(1,1,1,3,3-pentadeuteriopentan-2-yl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione (CAS 1219803-94-7) is a chemical compound with the molecular formula C12H18N2O3 and a molecular weight of 243.31 g/mol. IUPAC name: 5-(1,1,1,3,3-pentadeuteriopentan-2-yl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione. InChIKey: KQPKPCNLIDLUMF-SBRIIUNQSA-N.
| Molecular formula | C12H18N2O3 |
|---|---|
| Molecular weight | 243.31 g/mol |
| IUPAC name | 5-(1,1,1,3,3-pentadeuteriopentan-2-yl)-5-prop-2-enyl-1,3-diazinane-2,4,6-trione |
| InChIKey | KQPKPCNLIDLUMF-SBRIIUNQSA-N |
| SMILES | [2H]C([2H])([2H])C(C1(C(=O)NC(=O)NC1=O)CC=C)C([2H])([2H])CC |
Computed by PubChem (NCBI)