CAS 1219804-21-3 appears in our catalog under these names: 2,6-Difluorobenzoic-d3 Acid, 98 atom % D, min 98% Chemical Purity, 2,6-Difluorobenzoic acid-d3. Offered by: CDN, MedChemExpress. Available pack sizes: 0,25g, 0,1g, 1 mg.
3,4,5-trideuterio-2,6-difluorobenzoic acid (CAS 1219804-21-3) is a chemical compound with the molecular formula C7H4F2O2 and a molecular weight of 161.12 g/mol. IUPAC name: 3,4,5-trideuterio-2,6-difluorobenzoic acid. InChIKey: ONOTYLMNTZNAQZ-CBYSEHNBSA-N.
| Molecular formula | C7H4F2O2 |
|---|---|
| Molecular weight | 161.12 g/mol |
| IUPAC name | 3,4,5-trideuterio-2,6-difluorobenzoic acid |
| InChIKey | ONOTYLMNTZNAQZ-CBYSEHNBSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])F)C(=O)O)F)[2H] |
Computed by PubChem (NCBI)