CAS 1219804-65-5 appears in our catalog under these names: Phenoxyethanol-D4, 2-Phenoxyethyl-1,1,2,2-d4 Alcohol, 2-Phenoxyethyl-1,1,2,2-d4 Alcohol, 98 atom % D, min 98% Chemical Purity. Offered by: Chemat Brand, TRC, CDN, MedChemExpress. Available pack sizes: on request, 10mg, 50mg, 5mg, 0,5g, 0,25g, 5 mg, 10 mg.
1,1,2,2-tetradeuterio-2-phenoxyethanol (CAS 1219804-65-5) is a chemical compound with the molecular formula C8H10O2 and a molecular weight of 142.19 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-phenoxyethanol. InChIKey: QCDWFXQBSFUVSP-KXGHAPEVSA-N.
| Molecular formula | C8H10O2 |
|---|---|
| Molecular weight | 142.19 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-phenoxyethanol |
| InChIKey | QCDWFXQBSFUVSP-KXGHAPEVSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OC1=CC=CC=C1)O |
Computed by PubChem (NCBI)