CAS 21273-38-1 appears in our catalog under these names: 2-Phenoxyethanol-d2, >95% (GC), 2-Phenoxyethyl-1,1-d2 Alcohol, 98 atom % D, min 98% Chemical Purity, 2-Phenoxyethanol-1,1-d2, Phenoxyethanol-d2. Offered by: TRC, CDN, Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 0,5g, 0,25g, 25 mg, 50 mg, 10 mg.
1,1-dideuterio-2-phenoxyethanol (CAS 21273-38-1) is a chemical compound with the molecular formula C8H10O2 and a molecular weight of 140.18 g/mol. IUPAC name: 1,1-dideuterio-2-phenoxyethanol. InChIKey: QCDWFXQBSFUVSP-NCYHJHSESA-N.
| Molecular formula | C8H10O2 |
|---|---|
| Molecular weight | 140.18 g/mol |
| IUPAC name | 1,1-dideuterio-2-phenoxyethanol |
| InChIKey | QCDWFXQBSFUVSP-NCYHJHSESA-N |
| SMILES | [2H]C([2H])(COC1=CC=CC=C1)O |
Computed by PubChem (NCBI)