CAS 1219804-82-6 appears in our catalog under these names: (±)-Fluoxetine-d5 Oxalate (phenyl-d5), 99 atom % D, min 98% Chemical Purity, (±)–Fluoxetine–dd5 Oxalate (phenyl–dd5), (±)-Fluoxetine-d5 Oxalate (phenyl-d5), 99.90%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 1mg, 1 mg.
N-methyl-3-(2,3,4,5,6-pentadeuteriophenyl)-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;oxalic acid (CAS 1219804-82-6) is a chemical compound with the molecular formula C19H20F3NO5 and a molecular weight of 404.4 g/mol. IUPAC name: N-methyl-3-(2,3,4,5,6-pentadeuteriophenyl)-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;oxalic acid. InChIKey: CKOSCBUBUNGPOY-CERKJNTMSA-N.
| Molecular formula | C19H20F3NO5 |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | N-methyl-3-(2,3,4,5,6-pentadeuteriophenyl)-3-[4-(trifluoromethyl)phenoxy]propan-1-amine;oxalic acid |
| InChIKey | CKOSCBUBUNGPOY-CERKJNTMSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(CCNC)OC2=CC=C(C=C2)C(F)(F)F)[2H])[2H].C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)