Products 1253055-94-5
CAS 1253055-94-5 is the registry number for (R)-Methyl 3-amino-4-(2,4,5-trifluorophenyl)butanoate (R)-2-hydroxy-2-phenylacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-hydroxy-2-phenylacetic acid;methyl (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoate (CAS 1253055-94-5) is a chemical compound with the molecular formula C19H20F3NO5 and a molecular weight of 399.4 g/mol. IUPAC name: (2R)-2-hydroxy-2-phenylacetic acid;methyl (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoate. InChIKey: JBYIIBSXNYSNPK-HFEGYEGKSA-N.
| Molecular formula | C19H20F3NO5 |
|---|---|
| Molecular weight | 399.4 g/mol |
| IUPAC name | (2R)-2-hydroxy-2-phenylacetic acid;methyl (3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoate |
| InChIKey | JBYIIBSXNYSNPK-HFEGYEGKSA-N |
| SMILES | COC(=O)C[C@@H](CC1=CC(=C(C=C1F)F)F)N.C1=CC=C(C=C1)[C@H](C(=O)O)O |
Computed by PubChem (NCBI)