Products 1219805-32-9
CAS 1219805-32-9 appears in our catalog under these names: 3-Methyl-d3-butyric-3,4,4,4-d4 Acid, 3-Methyl-d3-butyric-3,4,4,4-d4 Acid, 98 atom % D, min 98% Chemical Purity, Isovaleric acid–d7, Isovaleric acid-d7, 99.47%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 0,25g, 0,1g, 5 mg, 10 mg, 50 mg.
3,4,4,4-tetradeuterio-3-(trideuteriomethyl)butanoic acid (CAS 1219805-32-9) is a chemical compound with the molecular formula C5H10O2 and a molecular weight of 109.17 g/mol. IUPAC name: 3,4,4,4-tetradeuterio-3-(trideuteriomethyl)butanoic acid. InChIKey: GWYFCOCPABKNJV-UAVYNJCWSA-N.
| Molecular formula | C5H10O2 |
|---|---|
| Molecular weight | 109.17 g/mol |
| IUPAC name | 3,4,4,4-tetradeuterio-3-(trideuteriomethyl)butanoic acid |
| InChIKey | GWYFCOCPABKNJV-UAVYNJCWSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(CC(=O)O)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)