Products 344298-81-3
CAS 344298-81-3 appears in our catalog under these names: Isovaleric Acid-d9, 3-Methylbutyric-d9 Acid, 98 atom % D, min 98% Chemical Purity, Isovaleric acid–d9, Isovaleric acid-d9, 98.52%, D9-Isovaleric acid. Offered by: TRC, CDN, GLPBio, MedChemExpress, HPC Standards. Available pack sizes: 250mg, 500mg, 50mg, 1g, 0,5g, 10mg, 25mg, 5mg.
2,2,3,4,4,4-hexadeuterio-3-(trideuteriomethyl)butanoic acid (CAS 344298-81-3) is a chemical compound with the molecular formula C5H10O2 and a molecular weight of 111.19 g/mol. IUPAC name: 2,2,3,4,4,4-hexadeuterio-3-(trideuteriomethyl)butanoic acid. InChIKey: GWYFCOCPABKNJV-CBZKUFJVSA-N.
| Molecular formula | C5H10O2 |
|---|---|
| Molecular weight | 111.19 g/mol |
| IUPAC name | 2,2,3,4,4,4-hexadeuterio-3-(trideuteriomethyl)butanoic acid |
| InChIKey | GWYFCOCPABKNJV-CBZKUFJVSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)