Products 1219805-36-3
CAS 1219805-36-3 appears in our catalog under these names: 4-(Methyl-d3-amino)butyric-2,2,3,3,4,4-d6 Acid HCl, 99 atom % D, min 98% Chemical Purity, 4-(Methylamino)butanoic acid-d9 hydrochloride. Offered by: CDN, MedChemExpress. Available pack sizes: 0,1g, 0,05g, 1 mg.
2,2,3,3,4,4-hexadeuterio-4-(trideuteriomethylamino)butanoic acid;hydrochloride (CAS 1219805-36-3) is a chemical compound with the molecular formula C5H12ClNO2 and a molecular weight of 162.66 g/mol. IUPAC name: 2,2,3,3,4,4-hexadeuterio-4-(trideuteriomethylamino)butanoic acid;hydrochloride. InChIKey: JMLHQRQZCMCQNJ-SRKCJUICSA-N.
| Molecular formula | C5H12ClNO2 |
|---|---|
| Molecular weight | 162.66 g/mol |
| IUPAC name | 2,2,3,3,4,4-hexadeuterio-4-(trideuteriomethylamino)butanoic acid;hydrochloride |
| InChIKey | JMLHQRQZCMCQNJ-SRKCJUICSA-N |
| SMILES | [2H]C([2H])([2H])NC([2H])([2H])C([2H])([2H])C([2H])([2H])C(=O)O.Cl |
Computed by PubChem (NCBI)