CAS 1219805-61-4 is the registry number for 3-Aminopyridine-d6, 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 1g, 0,5g.
N,N,2,4,5,6-hexadeuteriopyridin-3-amine (CAS 1219805-61-4) is a chemical compound with the molecular formula C5H6N2 and a molecular weight of 100.15 g/mol. IUPAC name: N,N,2,4,5,6-hexadeuteriopyridin-3-amine. InChIKey: CUYKNJBYIJFRCU-UDDMDDBKSA-N.
| Molecular formula | C5H6N2 |
|---|---|
| Molecular weight | 100.15 g/mol |
| IUPAC name | N,N,2,4,5,6-hexadeuteriopyridin-3-amine |
| InChIKey | CUYKNJBYIJFRCU-UDDMDDBKSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])N([2H])[2H])[2H] |
Computed by PubChem (NCBI)