CAS 1313510-25-6 is the registry number for 3-Aminopyridine-d4. Offered by: TRC. Available pack sizes: 25mg.
2,4,5,6-tetradeuteriopyridin-3-amine (CAS 1313510-25-6) is a chemical compound with the molecular formula C5H6N2 and a molecular weight of 98.14 g/mol. IUPAC name: 2,4,5,6-tetradeuteriopyridin-3-amine. InChIKey: CUYKNJBYIJFRCU-RHQRLBAQSA-N.
| Molecular formula | C5H6N2 |
|---|---|
| Molecular weight | 98.14 g/mol |
| IUPAC name | 2,4,5,6-tetradeuteriopyridin-3-amine |
| InChIKey | CUYKNJBYIJFRCU-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])N)[2H] |
Computed by PubChem (NCBI)