Products 1219805-73-8
CAS 1219805-73-8 is the registry number for Metaldehyde-d16. Offered by: TRC, MedChemExpress. Available pack sizes: 0,5mg, 10mg, 2,5mg, 500 μg.
2,4,6,8-tetradeuterio-2,4,6,8-tetrakis(trideuteriomethyl)-1,3,5,7-tetraoxocane (CAS 1219805-73-8) is a chemical compound with the molecular formula C8H16O4 and a molecular weight of 192.31 g/mol. IUPAC name: 2,4,6,8-tetradeuterio-2,4,6,8-tetrakis(trideuteriomethyl)-1,3,5,7-tetraoxocane. InChIKey: GKKDCARASOJPNG-WINJLYTNSA-N.
| Molecular formula | C8H16O4 |
|---|---|
| Molecular weight | 192.31 g/mol |
| IUPAC name | 2,4,6,8-tetradeuterio-2,4,6,8-tetrakis(trideuteriomethyl)-1,3,5,7-tetraoxocane |
| InChIKey | GKKDCARASOJPNG-WINJLYTNSA-N |
| SMILES | [2H]C1(OC(OC(OC(O1)([2H])C([2H])([2H])[2H])([2H])C([2H])([2H])[2H])([2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
Computed by PubChem (NCBI)