Products 1219805-76-1
CAS 1219805-76-1 appears in our catalog under these names: N-Nitrosomorpholine-d8, N-Nitrosomorpholine-d8, >95% (GC), N-Nitroso-morpholine D8, N-Nitrosomorpholine-d8, 98 atom % D, min 98% Chemical Purity, N–Nitrosomorpholine–d8. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, CDN, GLPBio. Available pack sizes: on request, 10mg, 1mg, 2,5mg, 25mg, 0,1g, 0,05g, 5mg.
2,2,3,3,5,5,6,6-octadeuterio-4-nitrosomorpholine (CAS 1219805-76-1) is a chemical compound with the molecular formula C4H8N2O2 and a molecular weight of 124.17 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuterio-4-nitrosomorpholine. InChIKey: ZKXDGKXYMTYWTB-SVYQBANQSA-N.
| Molecular formula | C4H8N2O2 |
|---|---|
| Molecular weight | 124.17 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuterio-4-nitrosomorpholine |
| InChIKey | ZKXDGKXYMTYWTB-SVYQBANQSA-N |
| SMILES | [2H]C1(C(OC(C(N1N=O)([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)