CAS 61578-30-1 appears in our catalog under these names: N-Nitrosomorpholine-d4, >95% (HPLC), N-Nitrosomorpholine-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.
3,3,5,5-tetradeuterio-4-nitrosomorpholine (CAS 61578-30-1) is a chemical compound with the molecular formula C4H8N2O2 and a molecular weight of 120.14 g/mol. IUPAC name: 3,3,5,5-tetradeuterio-4-nitrosomorpholine. InChIKey: ZKXDGKXYMTYWTB-LNLMKGTHSA-N.
| Molecular formula | C4H8N2O2 |
|---|---|
| Molecular weight | 120.14 g/mol |
| IUPAC name | 3,3,5,5-tetradeuterio-4-nitrosomorpholine |
| InChIKey | ZKXDGKXYMTYWTB-LNLMKGTHSA-N |
| SMILES | [2H]C1(COCC(N1N=O)([2H])[2H])[2H] |
Computed by PubChem (NCBI)