Products 1219806-44-6
CAS 1219806-44-6 appears in our catalog under these names: N-Tigloylglycine-2,2-d2, 98 atom % D, min 98% Chemical Purity, N-Tigloylglycine-2,2-d2. Offered by: CDN, MedChemExpress. Available pack sizes: 0,05g, 0,01g, 1mg, 5mg.
2,2-dideuterio-2-[[(E)-2-methylbut-2-enoyl]amino]acetic acid (CAS 1219806-44-6) is a chemical compound with the molecular formula C7H11NO3 and a molecular weight of 159.18 g/mol. IUPAC name: 2,2-dideuterio-2-[[(E)-2-methylbut-2-enoyl]amino]acetic acid. InChIKey: WRUSVQOKJIDBLP-YZOIYXFKSA-N.
| Molecular formula | C7H11NO3 |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 2,2-dideuterio-2-[[(E)-2-methylbut-2-enoyl]amino]acetic acid |
| InChIKey | WRUSVQOKJIDBLP-YZOIYXFKSA-N |
| SMILES | [2H]C([2H])(C(=O)O)NC(=O)/C(=C/C)/C |
Computed by PubChem (NCBI)