Products 1219908-86-7
CAS 1219908-86-7 appears in our catalog under these names: 4–Hydroxypropranolol–d7, 4-Hydroxypropranolol-d7. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg.
4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]naphthalen-1-ol (CAS 1219908-86-7) is a chemical compound with the molecular formula C16H21NO3 and a molecular weight of 282.39 g/mol. IUPAC name: 4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]naphthalen-1-ol. InChIKey: CWEPACWBWIOYID-UENXPIBQSA-N.
| Molecular formula | C16H21NO3 |
|---|---|
| Molecular weight | 282.39 g/mol |
| IUPAC name | 4-[3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)-2-hydroxypropoxy]naphthalen-1-ol |
| InChIKey | CWEPACWBWIOYID-UENXPIBQSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])NCC(COC1=CC=C(C2=CC=CC=C21)O)O |
Computed by PubChem (NCBI)