Products 1219956-77-0

CAS 1219956-77-0 is the registry number for 3-Pyrrolidinylmethyl 2-phenylacetate hydrochloride. Offered by: Biosynth. Available pack sizes: 250mg, 100mg, 500mg, 5000mg, 1000mg.

Structural formula: {0} (CAS {1})

Pyrrolidin-3-ylmethyl 2-phenylacetate;hydrochloride (CAS 1219956-77-0) is a chemical compound with the molecular formula C13H18ClNO2 and a molecular weight of 255.74 g/mol. IUPAC name: pyrrolidin-3-ylmethyl 2-phenylacetate;hydrochloride. InChIKey: FKTZKSWMLOHLPB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18ClNO2
Molecular weight255.74 g/mol
IUPAC namepyrrolidin-3-ylmethyl 2-phenylacetate;hydrochloride
InChIKeyFKTZKSWMLOHLPB-UHFFFAOYSA-N
SMILESC1CNCC1COC(=O)CC2=CC=CC=C2.Cl

Computed by PubChem (NCBI)