Products 1219967-90-4
CAS 1219967-90-4 is the registry number for 3-Chloro-2-(piperidin-1-yl)-5-(trifluoromethyl)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-chloro-2-piperidin-1-yl-5-(trifluoromethyl)pyridine (CAS 1219967-90-4) is a chemical compound with the molecular formula C11H12ClF3N2 and a molecular weight of 264.67 g/mol. IUPAC name: 3-chloro-2-piperidin-1-yl-5-(trifluoromethyl)pyridine. InChIKey: SYJHATHFKCHDPL-UHFFFAOYSA-N.
| Molecular formula | C11H12ClF3N2 |
|---|---|
| Molecular weight | 264.67 g/mol |
| IUPAC name | 3-chloro-2-piperidin-1-yl-5-(trifluoromethyl)pyridine |
| InChIKey | SYJHATHFKCHDPL-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=C(C=C(C=N2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)